C17H16ClN5O — CID 112947618
5-N-benzyl-3-N-(5-chloro-2-methoxyphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112947618) has the molecular formula C17H16ClN5O and a molecular weight of 341.80 g/mol. Its IUPAC name is 5-N-benzyl-3-N-(5-chloro-2-methoxyphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-benzyl-3-N-(5-chloro-2-methoxyphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112947618 |
| Molecular Formula | C17H16ClN5O |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 5-N-benzyl-3-N-(5-chloro-2-methoxyphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | COc1ccc(Cl)cc1Nc1nncc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C17H16ClN5O/c1-24-15-8-7-13(18)9-14(15)21-17-22-16(11-20-23-17)19-10-12-5-3-2-4-6-12/h2-9,11H,10H2,1H3,(H2,19,21,22,23) |
| InChIKey | FKTWDZRNRPKJNC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |