C25H16ClF4NO3 — CID 11294771
3-[2-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]-5-(trifluoromethyl)pyrrol-1-yl]benzoic acid (PubChem CID 11294771) has the molecular formula C25H16ClF4NO3 and a molecular weight of 489.85 g/mol. Its IUPAC name is 3-[2-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]-5-(trifluoromethyl)pyrrol-1-yl]benzoic acid.
| Compound Name | 3-[2-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]-5-(trifluoromethyl)pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 11294771 |
| Molecular Formula | C25H16ClF4NO3 |
| Molecular Weight | 489.85 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | 3-[2-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]-5-(trifluoromethyl)pyrrol-1-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-n2c(-c3cc(Cl)ccc3OCc3ccc(F)cc3)ccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C25H16ClF4NO3/c26-17-6-10-22(34-14-15-4-7-18(27)8-5-15)20(13-17)21-9-11-23(25(28,29)30)31(21)19-3-1-2-16(12-19)24(32)33/h1-13H,14H2,(H,32,33) |
| InChIKey | ICHVAUAKAIUONA-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.85 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|