C14H19N5 — CID 112947736
3-N-benzyl-5-N,5-N-diethyl-1,2,4-triazine-3,5-diamine (PubChem CID 112947736) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 3-N-benzyl-5-N,5-N-diethyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-benzyl-5-N,5-N-diethyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112947736 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 3-N-benzyl-5-N,5-N-diethyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCN(CC)c1cnnc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C14H19N5/c1-3-19(4-2)13-11-16-18-14(17-13)15-10-12-8-6-5-7-9-12/h5-9,11H,3-4,10H2,1-2H3,(H,15,17,18) |
| InChIKey | GSZQXYPTSYNLCP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |