C18H19N5 — CID 112947766
3-N-benzyl-5-N-(2,3-dimethylphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112947766) has the molecular formula C18H19N5 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-N-benzyl-5-N-(2,3-dimethylphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-benzyl-5-N-(2,3-dimethylphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112947766 |
| Molecular Formula | C18H19N5 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 3-N-benzyl-5-N-(2,3-dimethylphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Cc1cccc(Nc2cnnc(NCc3ccccc3)n2)c1C |
| InChI | InChI=1S/C18H19N5/c1-13-7-6-10-16(14(13)2)21-17-12-20-23-18(22-17)19-11-15-8-4-3-5-9-15/h3-10,12H,11H2,1-2H3,(H2,19,21,22,23) |
| InChIKey | IVNWNDDHRNQFNX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |