C26H54O3Si3 — CID 11294973
[(E)-3-[(2S,3R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyloxolan-2-yl]prop-2-enyl]-trimethylsilane (PubChem CID 11294973) has the molecular formula C26H54O3Si3 and a molecular weight of 498.97 g/mol. Its IUPAC name is [(E)-3-[(2S,3R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyloxolan-2-yl]prop-2-enyl]-trimethylsilane.
| Compound Name | [(E)-3-[(2S,3R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyloxolan-2-yl]prop-2-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 11294973 |
| Molecular Formula | C26H54O3Si3 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.34 |
| IUPAC Name | [(E)-3-[(2S,3R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyloxolan-2-yl]prop-2-enyl]-trimethylsilane |
| SMILES | C=C[C@H]1O[C@@H](/C=C/C[Si](C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H54O3Si3/c1-15-23-21(19-27-31(11,12)25(2,3)4)22(20-28-32(13,14)26(5,6)7)24(29-23)17-16-18-30(8,9)10/h15-17,21-24H,1,18-20H2,2-14H3/b17-16+/t21-,22+,23-,24+/m1/s1 |
| InChIKey | WMWFPEBDHOFBNB-CZFLPGETSA-N |
| XLogP | 8.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|