C31H33NO5 — CID 11294986
(4S,5R)-3-[(1S,2S,3S)-3-ethenyl-2-ethoxy-3-hydroxy-2-(phenylmethoxymethyl)cyclobutyl]-4,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 11294986) has the molecular formula C31H33NO5 and a molecular weight of 499.61 g/mol. Its IUPAC name is (4S,5R)-3-[(1S,2S,3S)-3-ethenyl-2-ethoxy-3-hydroxy-2-(phenylmethoxymethyl)cyclobutyl]-4,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-[(1S,2S,3S)-3-ethenyl-2-ethoxy-3-hydroxy-2-(phenylmethoxymethyl)cyclobutyl]-4,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11294986 |
| Molecular Formula | C31H33NO5 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | (4S,5R)-3-[(1S,2S,3S)-3-ethenyl-2-ethoxy-3-hydroxy-2-(phenylmethoxymethyl)cyclobutyl]-4,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@]1(O)C[C@H](N2C(=O)O[C@H](c3ccccc3)[C@@H]2c2ccccc2)[C@@]1(COCc1ccccc1)OCC |
| InChI | InChI=1S/C31H33NO5/c1-3-30(34)20-26(31(30,36-4-2)22-35-21-23-14-8-5-9-15-23)32-27(24-16-10-6-11-17-24)28(37-29(32)33)25-18-12-7-13-19-25/h3,5-19,26-28,34H,1,4,20-22H2,2H3/t26-,27-,28+,30+,31+/m0/s1 |
| InChIKey | ZDDQOPOJEJMTGF-XRXSYTHDSA-N |
| XLogP | 5.60 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|