C18H16FN5O2 — CID 112950157
5-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-N-[(4-fluorophenyl)methyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112950157) has the molecular formula C18H16FN5O2 and a molecular weight of 353.36 g/mol. Its IUPAC name is 5-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-N-[(4-fluorophenyl)methyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-N-[(4-fluorophenyl)methyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112950157 |
| Molecular Formula | C18H16FN5O2 |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 5-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-N-[(4-fluorophenyl)methyl]-1,2,4-triazine-3,5-diamine |
| SMILES | Fc1ccc(CNc2nncc(Nc3ccc4c(c3)OCCO4)n2)cc1 |
| InChI | InChI=1S/C18H16FN5O2/c19-13-3-1-12(2-4-13)10-20-18-23-17(11-21-24-18)22-14-5-6-15-16(9-14)26-8-7-25-15/h1-6,9,11H,7-8,10H2,(H2,20,22,23,24) |
| InChIKey | RFXXHGONFLQYKA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |