C28H33F3N2O3 — CID 11295041
3-[[(5E)-5-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]-7,8-dihydro-6H-naphthalen-2-yl]methylamino]propanoic acid (PubChem CID 11295041) has the molecular formula C28H33F3N2O3 and a molecular weight of 502.58 g/mol. Its IUPAC name is 3-[[(5E)-5-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]-7,8-dihydro-6H-naphthalen-2-yl]methylamino]propanoic acid.
| Compound Name | 3-[[(5E)-5-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]-7,8-dihydro-6H-naphthalen-2-yl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 11295041 |
| Molecular Formula | C28H33F3N2O3 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 3-[[(5E)-5-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxyimino]-7,8-dihydro-6H-naphthalen-2-yl]methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1ccc2c(c1)CCC/C2=N\OCc1ccc(C2CCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H33F3N2O3/c29-28(30,31)25-16-20(10-11-23(25)21-5-2-1-3-6-21)18-36-33-26-8-4-7-22-15-19(9-12-24(22)26)17-32-14-13-27(34)35/h9-12,15-16,21,32H,1-8,13-14,17-18H2,(H,34,35)/b33-26+ |
| InChIKey | KXUGYIBWAYBOQD-MHTZHOPKSA-N |
| XLogP | 6.57 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|