C26H26N6OS2 — CID 11295047
[4,6-bis(3-methylanilino)-1,3,5-triazin-2-yl] N-(4-ethoxyphenyl)carbamodithioate (PubChem CID 11295047) has the molecular formula C26H26N6OS2 and a molecular weight of 502.67 g/mol. Its IUPAC name is [4,6-bis(3-methylanilino)-1,3,5-triazin-2-yl] N-(4-ethoxyphenyl)carbamodithioate.
| Compound Name | [4,6-bis(3-methylanilino)-1,3,5-triazin-2-yl] N-(4-ethoxyphenyl)carbamodithioate |
|---|---|
| PubChem CID | 11295047 |
| Molecular Formula | C26H26N6OS2 |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | [4,6-bis(3-methylanilino)-1,3,5-triazin-2-yl] N-(4-ethoxyphenyl)carbamodithioate |
| SMILES | CCOc1ccc(NC(=S)Sc2nc(Nc3cccc(C)c3)nc(Nc3cccc(C)c3)n2)cc1 |
| InChI | InChI=1S/C26H26N6OS2/c1-4-33-22-13-11-19(12-14-22)29-26(34)35-25-31-23(27-20-9-5-7-17(2)15-20)30-24(32-25)28-21-10-6-8-18(3)16-21/h5-16H,4H2,1-3H3,(H,29,34)(H2,27,28,30,31,32) |
| InChIKey | QIHXGLLPDFVIRI-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|