C20H21N5O4 — CID 112951454
3-N-(1,3-benzodioxol-5-ylmethyl)-5-N-[2-(4-methoxyphenoxy)ethyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112951454) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is 3-N-(1,3-benzodioxol-5-ylmethyl)-5-N-[2-(4-methoxyphenoxy)ethyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(1,3-benzodioxol-5-ylmethyl)-5-N-[2-(4-methoxyphenoxy)ethyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112951454 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-N-(1,3-benzodioxol-5-ylmethyl)-5-N-[2-(4-methoxyphenoxy)ethyl]-1,2,4-triazine-3,5-diamine |
| SMILES | COc1ccc(OCCNc2cnnc(NCc3ccc4c(c3)OCO4)n2)cc1 |
| InChI | InChI=1S/C20H21N5O4/c1-26-15-3-5-16(6-4-15)27-9-8-21-19-12-23-25-20(24-19)22-11-14-2-7-17-18(10-14)29-13-28-17/h2-7,10,12H,8-9,11,13H2,1H3,(H2,21,22,24,25) |
| InChIKey | FXOWRJQUIWCSIW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|