C19H18ClN5O2 — CID 112951500
3-N-(1,3-benzodioxol-5-ylmethyl)-5-N-(2-chloro-4,6-dimethylphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112951500) has the molecular formula C19H18ClN5O2 and a molecular weight of 383.84 g/mol. Its IUPAC name is 3-N-(1,3-benzodioxol-5-ylmethyl)-5-N-(2-chloro-4,6-dimethylphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(1,3-benzodioxol-5-ylmethyl)-5-N-(2-chloro-4,6-dimethylphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112951500 |
| Molecular Formula | C19H18ClN5O2 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 3-N-(1,3-benzodioxol-5-ylmethyl)-5-N-(2-chloro-4,6-dimethylphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Cc1cc(C)c(Nc2cnnc(NCc3ccc4c(c3)OCO4)n2)c(Cl)c1 |
| InChI | InChI=1S/C19H18ClN5O2/c1-11-5-12(2)18(14(20)6-11)23-17-9-22-25-19(24-17)21-8-13-3-4-15-16(7-13)27-10-26-15/h3-7,9H,8,10H2,1-2H3,(H2,21,23,24,25) |
| InChIKey | RQMOQZVQLPHPLJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |