About 11-(2,3,4-trimethoxyphenyl)benzo[c]phenanthridin-6-amine
11-(2,3,4-trimethoxyphenyl)benzo[c]phenanthridin-6-amine (PubChem CID 11295194) has the molecular formula C26H22N2O3
and a molecular weight of 410.47 g/mol. Its IUPAC name is 11-(2,3,4-trimethoxyphenyl)benzo[c]phenanthridin-6-amine.
Molecular Properties
| Compound Name | 11-(2,3,4-trimethoxyphenyl)benzo[c]phenanthridin-6-amine |
| PubChem CID | 11295194 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 11-(2,3,4-trimethoxyphenyl)benzo[c]phenanthridin-6-amine |
| SMILES | COc1ccc(-c2cc3ccccc3c3nc(N)c4ccccc4c23)c(OC)c1OC |
| InChI | InChI=1S/C26H22N2O3/c1-29-21-13-12-18(24(30-2)25(21)31-3)20-14-15-8-4-5-9-16(15)23-22(20)17-10-6-7-11-19(17)26(27)28-23/h4-14H,1-3H3,(H2,27,28) |
| InChIKey | KWXWKOIDNARNDI-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 11-(2,3,4-trimethoxyphenyl)benzo[c]phenanthridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-(2,3,4-trimethoxyphenyl)benzo[c]phenanthridin-6-amine?
The IUPAC name of 11-(2,3,4-trimethoxyphenyl)benzo[c]phenanthridin-6-amine (CID 11295194) is 11-(2,3,4-trimethoxyphenyl)benzo[c]phenanthridin-6-amine.
What is the SMILES notation for 11-(2,3,4-trimethoxyphenyl)benzo[c]phenanthridin-6-amine?
The canonical SMILES for 11-(2,3,4-trimethoxyphenyl)benzo[c]phenanthridin-6-amine is COc1ccc(-c2cc3ccccc3c3nc(N)c4ccccc4c23)c(OC)c1OC.
What is the InChIKey of 11-(2,3,4-trimethoxyphenyl)benzo[c]phenanthridin-6-amine?
The InChIKey is KWXWKOIDNARNDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N2O3/c1-29-21-13-12-18(24(30-2)25(21)31-3)20-14-15-8-4-5-9-16(15)23-22(20)17-10-6-7-11-19(17)26(27)28-23/h4-14H,1-3H3,(H2,27,28).
What are the key properties of 11-(2,3,4-trimethoxyphenyl)benzo[c]phenanthridin-6-amine?
11-(2,3,4-trimethoxyphenyl)benzo[c]phenanthridin-6-amine has a molecular weight of 410.47 g/mol, XLogP of 5.82, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 11-(2,3,4-trimethoxyphenyl)benzo[c]phenanthridin-6-amine is sourced from PubChem (CID 11295194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).