C28H31F2N3O4 — CID 11295207
(3R,6R)-1-[(1R)-1-(2,4-difluorophenyl)-2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]-3-(2,3-dihydro-1H-inden-2-yl)-6-(2-methylpropyl)piperazine-2,5-dione (PubChem CID 11295207) has the molecular formula C28H31F2N3O4 and a molecular weight of 511.57 g/mol. Its IUPAC name is (3R,6R)-1-[(1R)-1-(2,4-difluorophenyl)-2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]-3-(2,3-dihydro-1H-inden-2-yl)-6-(2-methylpropyl)piperazine-2,5-dione.
| Compound Name | (3R,6R)-1-[(1R)-1-(2,4-difluorophenyl)-2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]-3-(2,3-dihydro-1H-inden-2-yl)-6-(2-methylpropyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 11295207 |
| Molecular Formula | C28H31F2N3O4 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | (3R,6R)-1-[(1R)-1-(2,4-difluorophenyl)-2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]-3-(2,3-dihydro-1H-inden-2-yl)-6-(2-methylpropyl)piperazine-2,5-dione |
| SMILES | CC(C)C[C@@H]1C(=O)N[C@H](C2Cc3ccccc3C2)C(=O)N1[C@@H](C(=O)N1CC(O)C1)c1ccc(F)cc1F |
| InChI | InChI=1S/C28H31F2N3O4/c1-15(2)9-23-26(35)31-24(18-10-16-5-3-4-6-17(16)11-18)27(36)33(23)25(28(37)32-13-20(34)14-32)21-8-7-19(29)12-22(21)30/h3-8,12,15,18,20,23-25,34H,9-11,13-14H2,1-2H3,(H,31,35)/t23-,24-,25-/m1/s1 |
| InChIKey | KAAHDXPPRHCZDL-UBFVSLLYSA-N |
| XLogP | 2.37 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |