C30H46O5Si — CID 11295275
tert-butyl-[(4S,6R,7R)-6-[(4-methoxyphenyl)methoxy]-7-(phenylmethoxymethoxy)oct-1-en-4-yl]oxy-dimethylsilane (PubChem CID 11295275) has the molecular formula C30H46O5Si and a molecular weight of 514.78 g/mol. Its IUPAC name is tert-butyl-[(4S,6R,7R)-6-[(4-methoxyphenyl)methoxy]-7-(phenylmethoxymethoxy)oct-1-en-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4S,6R,7R)-6-[(4-methoxyphenyl)methoxy]-7-(phenylmethoxymethoxy)oct-1-en-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11295275 |
| Molecular Formula | C30H46O5Si |
| Molecular Weight | 514.78 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | tert-butyl-[(4S,6R,7R)-6-[(4-methoxyphenyl)methoxy]-7-(phenylmethoxymethoxy)oct-1-en-4-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@@H](C[C@@H](OCc1ccc(OC)cc1)[C@@H](C)OCOCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H46O5Si/c1-9-13-28(35-36(7,8)30(3,4)5)20-29(33-22-26-16-18-27(31-6)19-17-26)24(2)34-23-32-21-25-14-11-10-12-15-25/h9-12,14-19,24,28-29H,1,13,20-23H2,2-8H3/t24-,28+,29-/m1/s1 |
| InChIKey | YCUNTLLMRVNNER-OFQAEJFBSA-N |
| XLogP | 7.52 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.78 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|