C19H21FN6 — CID 112953468
3-N-[4-(dimethylamino)phenyl]-5-N-[2-(2-fluorophenyl)ethyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112953468) has the molecular formula C19H21FN6 and a molecular weight of 352.42 g/mol. Its IUPAC name is 3-N-[4-(dimethylamino)phenyl]-5-N-[2-(2-fluorophenyl)ethyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-[4-(dimethylamino)phenyl]-5-N-[2-(2-fluorophenyl)ethyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112953468 |
| Molecular Formula | C19H21FN6 |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 3-N-[4-(dimethylamino)phenyl]-5-N-[2-(2-fluorophenyl)ethyl]-1,2,4-triazine-3,5-diamine |
| SMILES | CN(C)c1ccc(Nc2nncc(NCCc3ccccc3F)n2)cc1 |
| InChI | InChI=1S/C19H21FN6/c1-26(2)16-9-7-15(8-10-16)23-19-24-18(13-22-25-19)21-12-11-14-5-3-4-6-17(14)20/h3-10,13H,11-12H2,1-2H3,(H2,21,23,24,25) |
| InChIKey | QPCFJLQRPITKFI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|