C31H40O5S — CID 11295414
2-[4-[(E)-3-[4-(2-cyclohexylsulfanylethoxy)-3,5-dimethylphenyl]-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid (PubChem CID 11295414) has the molecular formula C31H40O5S and a molecular weight of 524.72 g/mol. Its IUPAC name is 2-[4-[(E)-3-[4-(2-cyclohexylsulfanylethoxy)-3,5-dimethylphenyl]-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[(E)-3-[4-(2-cyclohexylsulfanylethoxy)-3,5-dimethylphenyl]-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 11295414 |
| Molecular Formula | C31H40O5S |
| Molecular Weight | 524.72 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 2-[4-[(E)-3-[4-(2-cyclohexylsulfanylethoxy)-3,5-dimethylphenyl]-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid |
| SMILES | Cc1cc(C(=O)/C=C/c2cc(C)c(OC(C)(C)C(=O)O)c(C)c2)cc(C)c1OCCSC1CCCCC1 |
| InChI | InChI=1S/C31H40O5S/c1-20-16-24(17-21(2)29(20)36-31(5,6)30(33)34)12-13-27(32)25-18-22(3)28(23(4)19-25)35-14-15-37-26-10-8-7-9-11-26/h12-13,16-19,26H,7-11,14-15H2,1-6H3,(H,33,34)/b13-12+ |
| InChIKey | AMISKGFVZHOVOT-OUKQBFOZSA-N |
| XLogP | 7.50 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.72 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|