C33H39N3O3 — CID 11295426
(3S)-2-(4-cyclohexyloxypyridine-2-carbonyl)-N-(4-pentylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 11295426) has the molecular formula C33H39N3O3 and a molecular weight of 525.69 g/mol. Its IUPAC name is (3S)-2-(4-cyclohexyloxypyridine-2-carbonyl)-N-(4-pentylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-2-(4-cyclohexyloxypyridine-2-carbonyl)-N-(4-pentylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 11295426 |
| Molecular Formula | C33H39N3O3 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | (3S)-2-(4-cyclohexyloxypyridine-2-carbonyl)-N-(4-pentylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CCCCCc1ccc(NC(=O)[C@@H]2Cc3ccccc3CN2C(=O)c2cc(OC3CCCCC3)ccn2)cc1 |
| InChI | InChI=1S/C33H39N3O3/c1-2-3-5-10-24-15-17-27(18-16-24)35-32(37)31-21-25-11-8-9-12-26(25)23-36(31)33(38)30-22-29(19-20-34-30)39-28-13-6-4-7-14-28/h8-9,11-12,15-20,22,28,31H,2-7,10,13-14,21,23H2,1H3,(H,35,37)/t31-/m0/s1 |
| InChIKey | QRVANRQQVMCJEW-HKBQPEDESA-N |
| XLogP | 6.73 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|