C28H32F6N2O — CID 11295434
trans-(1S,3R)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-propan-2-yl-3-(1,2,3,4-tetrahydronaphthalen-1-ylamino)cyclopentane-1-carboxamide (PubChem CID 11295434) has the molecular formula C28H32F6N2O and a molecular weight of 526.57 g/mol. Its IUPAC name is trans-(1S,3R)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-propan-2-yl-3-(1,2,3,4-tetrahydronaphthalen-1-ylamino)cyclopentane-1-carboxamide.
| Compound Name | trans-(1S,3R)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-propan-2-yl-3-(1,2,3,4-tetrahydronaphthalen-1-ylamino)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 11295434 |
| Molecular Formula | C28H32F6N2O |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | trans-(1S,3R)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-propan-2-yl-3-(1,2,3,4-tetrahydronaphthalen-1-ylamino)cyclopentane-1-carboxamide |
| SMILES | CC(C)[C@]1(C(=O)NCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC[C@@H](NC2CCCc3ccccc32)C1 |
| InChI | InChI=1S/C28H32F6N2O/c1-17(2)26(11-10-22(15-26)36-24-9-5-7-19-6-3-4-8-23(19)24)25(37)35-16-18-12-20(27(29,30)31)14-21(13-18)28(32,33)34/h3-4,6,8,12-14,17,22,24,36H,5,7,9-11,15-16H2,1-2H3,(H,35,37)/t22-,24?,26+/m1/s1 |
| InChIKey | UGBQKYVMRZGCSO-OVQDZVAUSA-N |
| XLogP | 7.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |