C25H26FNP+ — CID 11295643
[(Z)-2-fluoro-2-piperidin-1-ylethenyl]-triphenylphosphanium (PubChem CID 11295643) has the molecular formula C25H26FNP+ and a molecular weight of 390.46 g/mol. Its IUPAC name is [(Z)-2-fluoro-2-piperidin-1-ylethenyl]-triphenylphosphanium.
| Compound Name | [(Z)-2-fluoro-2-piperidin-1-ylethenyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 11295643 |
| Molecular Formula | C25H26FNP+ |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | [(Z)-2-fluoro-2-piperidin-1-ylethenyl]-triphenylphosphanium |
| SMILES | F/C(=C\[P+](c1ccccc1)(c1ccccc1)c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C25H26FNP/c26-25(27-19-11-4-12-20-27)21-28(22-13-5-1-6-14-22,23-15-7-2-8-16-23)24-17-9-3-10-18-24/h1-3,5-10,13-18,21H,4,11-12,19-20H2/q+1/b25-21+ |
| InChIKey | DPVSWGJMEFPLAB-NJNXFGOHSA-N |
| XLogP | 5.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|