About N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzenesulfonamide
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzenesulfonamide (PubChem CID 1129586) has the molecular formula C16H18N2O6S
and a molecular weight of 366.40 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzenesulfonamide.
Molecular Properties
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzenesulfonamide |
| PubChem CID | 1129586 |
| Molecular Formula | C16H18N2O6S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzenesulfonamide |
| SMILES | COc1ccc(CCNS(=O)(=O)c2ccccc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H18N2O6S/c1-23-14-8-7-12(11-15(14)24-2)9-10-17-25(21,22)16-6-4-3-5-13(16)18(19)20/h3-8,11,17H,9-10H2,1-2H3 |
| InChIKey | HDSYWTAQKQHJQM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzenesulfonamide?
The IUPAC name of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzenesulfonamide (CID 1129586) is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzenesulfonamide.
What is the SMILES notation for N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzenesulfonamide?
The canonical SMILES for N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzenesulfonamide is COc1ccc(CCNS(=O)(=O)c2ccccc2[N+](=O)[O-])cc1OC.
What is the InChIKey of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzenesulfonamide?
The InChIKey is HDSYWTAQKQHJQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O6S/c1-23-14-8-7-12(11-15(14)24-2)9-10-17-25(21,22)16-6-4-3-5-13(16)18(19)20/h3-8,11,17H,9-10H2,1-2H3.
What are the key properties of N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzenesulfonamide?
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzenesulfonamide has a molecular weight of 366.40 g/mol, XLogP of 2.13, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dimethoxyphenyl)ethyl]-2-nitrobenzenesulfonamide is sourced from PubChem (CID 1129586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).