C21H25N5O3 — CID 112958706
5-N-[2-(4-methoxyphenoxy)ethyl]-3-N-(4-propan-2-yloxyphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112958706) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 5-N-[2-(4-methoxyphenoxy)ethyl]-3-N-(4-propan-2-yloxyphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-[2-(4-methoxyphenoxy)ethyl]-3-N-(4-propan-2-yloxyphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112958706 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 5-N-[2-(4-methoxyphenoxy)ethyl]-3-N-(4-propan-2-yloxyphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | COc1ccc(OCCNc2cnnc(Nc3ccc(OC(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C21H25N5O3/c1-15(2)29-19-6-4-16(5-7-19)24-21-25-20(14-23-26-21)22-12-13-28-18-10-8-17(27-3)9-11-18/h4-11,14-15H,12-13H2,1-3H3,(H2,22,24,25,26) |
| InChIKey | SNHMYPNUICVRQR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|