C29H30Cl2F2N4O — CID 11295934
4-[[N-cyclohexyl-N'-[(3,5-difluorophenyl)methyl]carbamimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide (PubChem CID 11295934) has the molecular formula C29H30Cl2F2N4O and a molecular weight of 559.49 g/mol. Its IUPAC name is 4-[[N-cyclohexyl-N'-[(3,5-difluorophenyl)methyl]carbamimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide.
| Compound Name | 4-[[N-cyclohexyl-N'-[(3,5-difluorophenyl)methyl]carbamimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 11295934 |
| Molecular Formula | C29H30Cl2F2N4O |
| Molecular Weight | 559.49 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 4-[[N-cyclohexyl-N'-[(3,5-difluorophenyl)methyl]carbamimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)c1ccc(N/C(=N/Cc2cc(F)cc(F)c2)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C29H30Cl2F2N4O/c30-22-9-6-20(27(31)16-22)12-13-34-28(38)21-7-10-26(11-8-21)37-29(36-25-4-2-1-3-5-25)35-18-19-14-23(32)17-24(33)15-19/h6-11,14-17,25H,1-5,12-13,18H2,(H,34,38)(H2,35,36,37) |
| InChIKey | NCVUUCYJZPFVEV-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.49 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|