C27H56O2SiSn — CID 11295937
(3R,5Z)-7-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyl-2-tributylstannylhepta-1,5-dien-3-ol (PubChem CID 11295937) has the molecular formula C27H56O2SiSn and a molecular weight of 559.54 g/mol. Its IUPAC name is (3R,5Z)-7-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyl-2-tributylstannylhepta-1,5-dien-3-ol.
| Compound Name | (3R,5Z)-7-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyl-2-tributylstannylhepta-1,5-dien-3-ol |
|---|---|
| PubChem CID | 11295937 |
| Molecular Formula | C27H56O2SiSn |
| Molecular Weight | 559.54 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | (3R,5Z)-7-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyl-2-tributylstannylhepta-1,5-dien-3-ol |
| SMILES | C=C([C@H](O)C/C(C)=C(/C)CO[Si](C)(C)C(C)(C)C)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C15H29O2Si.3C4H9.Sn/c1-9-14(16)10-12(2)13(3)11-17-18(7,8)15(4,5)6;3*1-3-4-2;/h14,16H,1,10-11H2,2-8H3;3*1,3-4H2,2H3;/b13-12-;;;;/t14-;;;;/m0..../s1 |
| InChIKey | JBDWRIJYAROOFL-VTKUFZEVSA-N |
| XLogP | 9.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.54 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|