C29H36O11 — CID 11295948
[(1S,2S,3R,4S,5S,7S,8S,9S,12S)-5-acetyloxy-4,7,9,12-tetrahydroxy-4-(hydroxymethyl)-8,11,14,14-tetramethyl-16-oxo-15-oxatetracyclo[7.4.3.01,10.03,8]hexadec-10-en-2-yl] benzoate (PubChem CID 11295948) has the molecular formula C29H36O11 and a molecular weight of 560.60 g/mol. Its IUPAC name is [(1S,2S,3R,4S,5S,7S,8S,9S,12S)-5-acetyloxy-4,7,9,12-tetrahydroxy-4-(hydroxymethyl)-8,11,14,14-tetramethyl-16-oxo-15-oxatetracyclo[7.4.3.01,10.03,8]hexadec-10-en-2-yl] benzoate.
| Compound Name | [(1S,2S,3R,4S,5S,7S,8S,9S,12S)-5-acetyloxy-4,7,9,12-tetrahydroxy-4-(hydroxymethyl)-8,11,14,14-tetramethyl-16-oxo-15-oxatetracyclo[7.4.3.01,10.03,8]hexadec-10-en-2-yl] benzoate |
|---|---|
| PubChem CID | 11295948 |
| Molecular Formula | C29H36O11 |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | [(1S,2S,3R,4S,5S,7S,8S,9S,12S)-5-acetyloxy-4,7,9,12-tetrahydroxy-4-(hydroxymethyl)-8,11,14,14-tetramethyl-16-oxo-15-oxatetracyclo[7.4.3.01,10.03,8]hexadec-10-en-2-yl] benzoate |
| SMILES | CC(=O)O[C@H]1C[C@H](O)[C@]2(C)[C@H]([C@H](OC(=O)c3ccccc3)[C@]34C[C@H](O)C(C)=C3[C@@]2(O)C(=O)OC4(C)C)[C@]1(O)CO |
| InChI | InChI=1S/C29H36O11/c1-14-17(32)12-27-20(14)29(37,24(35)40-25(27,3)4)26(5)18(33)11-19(38-15(2)31)28(36,13-30)21(26)22(27)39-23(34)16-9-7-6-8-10-16/h6-10,17-19,21-22,30,32-33,36-37H,11-13H2,1-5H3/t17-,18-,19-,21-,22-,26+,27-,28-,29+/m0/s1 |
| InChIKey | SPVRLXGJRZEFBD-DXMBEVNWSA-N |
| XLogP | 0.40 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|