C31H27F3N2O5 — CID 11295996
1-O-benzyl 8-O-methyl (3aS,4S,9bS)-4-[(E)-2-phenylethenyl]-5-(2,2,2-trifluoroacetyl)-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1,8-dicarboxylate (PubChem CID 11295996) has the molecular formula C31H27F3N2O5 and a molecular weight of 564.56 g/mol. Its IUPAC name is 1-O-benzyl 8-O-methyl (3aS,4S,9bS)-4-[(E)-2-phenylethenyl]-5-(2,2,2-trifluoroacetyl)-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1,8-dicarboxylate.
| Compound Name | 1-O-benzyl 8-O-methyl (3aS,4S,9bS)-4-[(E)-2-phenylethenyl]-5-(2,2,2-trifluoroacetyl)-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1,8-dicarboxylate |
|---|---|
| PubChem CID | 11295996 |
| Molecular Formula | C31H27F3N2O5 |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 1-O-benzyl 8-O-methyl (3aS,4S,9bS)-4-[(E)-2-phenylethenyl]-5-(2,2,2-trifluoroacetyl)-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1,8-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@@H]1[C@@H](CCN1C(=O)OCc1ccccc1)[C@H](/C=C/c1ccccc1)N2C(=O)C(F)(F)F |
| InChI | InChI=1S/C31H27F3N2O5/c1-40-28(37)22-13-15-26-24(18-22)27-23(16-17-35(27)30(39)41-19-21-10-6-3-7-11-21)25(36(26)29(38)31(32,33)34)14-12-20-8-4-2-5-9-20/h2-15,18,23,25,27H,16-17,19H2,1H3/b14-12+/t23-,25-,27-/m0/s1 |
| InChIKey | IDYQGGNSLQXNCQ-KRMFFUQWSA-N |
| XLogP | 6.16 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |