C16H13N5O2 — CID 112961708
5-N-(1,3-benzodioxol-5-yl)-3-N-phenyl-1,2,4-triazine-3,5-diamine (PubChem CID 112961708) has the molecular formula C16H13N5O2 and a molecular weight of 307.31 g/mol. Its IUPAC name is 5-N-(1,3-benzodioxol-5-yl)-3-N-phenyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(1,3-benzodioxol-5-yl)-3-N-phenyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112961708 |
| Molecular Formula | C16H13N5O2 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 5-N-(1,3-benzodioxol-5-yl)-3-N-phenyl-1,2,4-triazine-3,5-diamine |
| SMILES | c1ccc(Nc2nncc(Nc3ccc4c(c3)OCO4)n2)cc1 |
| InChI | InChI=1S/C16H13N5O2/c1-2-4-11(5-3-1)19-16-20-15(9-17-21-16)18-12-6-7-13-14(8-12)23-10-22-13/h1-9H,10H2,(H2,18,19,20,21) |
| InChIKey | DJQMHDSUEKXFFL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |