C26H42N5O8P — CID 11296203
[[1-[(2-amino-6-butylpurin-9-yl)methyl]cyclopropyl]oxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 11296203) has the molecular formula C26H42N5O8P and a molecular weight of 583.62 g/mol. Its IUPAC name is [[1-[(2-amino-6-butylpurin-9-yl)methyl]cyclopropyl]oxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [[1-[(2-amino-6-butylpurin-9-yl)methyl]cyclopropyl]oxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11296203 |
| Molecular Formula | C26H42N5O8P |
| Molecular Weight | 583.62 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | [[1-[(2-amino-6-butylpurin-9-yl)methyl]cyclopropyl]oxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CCCCc1nc(N)nc2c1ncn2CC1(OCP(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C26H42N5O8P/c1-8-9-10-18-19-20(30-23(27)29-18)31(14-28-19)13-26(11-12-26)37-17-40(34,38-15-35-21(32)24(2,3)4)39-16-36-22(33)25(5,6)7/h14H,8-13,15-17H2,1-7H3,(H2,27,29,30) |
| InChIKey | SGMYKMADKRQARU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 166.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.62 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|