C26H18Cl4N4S2 — CID 11296283
1-N,3-N-bis[4-(2,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-yl]benzene-1,3-diamine (PubChem CID 11296283) has the molecular formula C26H18Cl4N4S2 and a molecular weight of 592.40 g/mol. Its IUPAC name is 1-N,3-N-bis[4-(2,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-yl]benzene-1,3-diamine.
| Compound Name | 1-N,3-N-bis[4-(2,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 11296283 |
| Molecular Formula | C26H18Cl4N4S2 |
| Molecular Weight | 592.40 g/mol |
| Exact Mass | 589.97 |
| IUPAC Name | 1-N,3-N-bis[4-(2,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-yl]benzene-1,3-diamine |
| SMILES | Cc1sc(Nc2cccc(Nc3nc(-c4ccc(Cl)cc4Cl)c(C)s3)c2)nc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H18Cl4N4S2/c1-13-23(19-8-6-15(27)10-21(19)29)33-25(35-13)31-17-4-3-5-18(12-17)32-26-34-24(14(2)36-26)20-9-7-16(28)11-22(20)30/h3-12H,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | ROLVDZIRHOCRBZ-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.40 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |