C19H21N5 — CID 112963643
3-N,5-N-bis(2,6-dimethylphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112963643) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-N,5-N-bis(2,6-dimethylphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N,5-N-bis(2,6-dimethylphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112963643 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 3-N,5-N-bis(2,6-dimethylphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Cc1cccc(C)c1Nc1cnnc(Nc2c(C)cccc2C)n1 |
| InChI | InChI=1S/C19H21N5/c1-12-7-5-8-13(2)17(12)21-16-11-20-24-19(22-16)23-18-14(3)9-6-10-15(18)4/h5-11H,1-4H3,(H2,21,22,23,24) |
| InChIKey | JEQYPZDFOKIEJY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |