C19H18N6 — CID 112964750
4-[[3-(2-propan-2-ylanilino)-1,2,4-triazin-5-yl]amino]benzonitrile (PubChem CID 112964750) has the molecular formula C19H18N6 and a molecular weight of 330.40 g/mol. Its IUPAC name is 4-[[3-(2-propan-2-ylanilino)-1,2,4-triazin-5-yl]amino]benzonitrile.
| Compound Name | 4-[[3-(2-propan-2-ylanilino)-1,2,4-triazin-5-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112964750 |
| Molecular Formula | C19H18N6 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-[[3-(2-propan-2-ylanilino)-1,2,4-triazin-5-yl]amino]benzonitrile |
| SMILES | CC(C)c1ccccc1Nc1nncc(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C19H18N6/c1-13(2)16-5-3-4-6-17(16)23-19-24-18(12-21-25-19)22-15-9-7-14(11-20)8-10-15/h3-10,12-13H,1-2H3,(H2,22,23,24,25) |
| InChIKey | SFASIZJGDNWWRS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |