C16H10F2N6 — CID 112969699
3-[[3-(2,6-difluoroanilino)-1,2,4-triazin-5-yl]amino]benzonitrile (PubChem CID 112969699) has the molecular formula C16H10F2N6 and a molecular weight of 324.29 g/mol. Its IUPAC name is 3-[[3-(2,6-difluoroanilino)-1,2,4-triazin-5-yl]amino]benzonitrile.
| Compound Name | 3-[[3-(2,6-difluoroanilino)-1,2,4-triazin-5-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112969699 |
| Molecular Formula | C16H10F2N6 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 3-[[3-(2,6-difluoroanilino)-1,2,4-triazin-5-yl]amino]benzonitrile |
| SMILES | N#Cc1cccc(Nc2cnnc(Nc3c(F)cccc3F)n2)c1 |
| InChI | InChI=1S/C16H10F2N6/c17-12-5-2-6-13(18)15(12)23-16-22-14(9-20-24-16)21-11-4-1-3-10(7-11)8-19/h1-7,9H,(H2,21,22,23,24) |
| InChIKey | MPNOWKFXLJCJGE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |