C18H21FN2O2 — CID 112970324
1-ethyl-3-[2-(2-fluorophenoxy)ethyl]-1-(3-methylphenyl)urea (PubChem CID 112970324) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-fluorophenoxy)ethyl]-1-(3-methylphenyl)urea.
| Compound Name | 1-ethyl-3-[2-(2-fluorophenoxy)ethyl]-1-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 112970324 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-ethyl-3-[2-(2-fluorophenoxy)ethyl]-1-(3-methylphenyl)urea |
| SMILES | CCN(C(=O)NCCOc1ccccc1F)c1cccc(C)c1 |
| InChI | InChI=1S/C18H21FN2O2/c1-3-21(15-8-6-7-14(2)13-15)18(22)20-11-12-23-17-10-5-4-9-16(17)19/h4-10,13H,3,11-12H2,1-2H3,(H,20,22) |
| InChIKey | OGSBLBOESAGWEY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|