C42H52O5S2Si — CID 11297128
trimethyl-[2-[[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-dithian-2-yl]silane (PubChem CID 11297128) has the molecular formula C42H52O5S2Si and a molecular weight of 729.09 g/mol. Its IUPAC name is trimethyl-[2-[[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-dithian-2-yl]silane.
| Compound Name | trimethyl-[2-[[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-dithian-2-yl]silane |
|---|---|
| PubChem CID | 11297128 |
| Molecular Formula | C42H52O5S2Si |
| Molecular Weight | 729.09 g/mol |
| Exact Mass | 728.30 |
| IUPAC Name | trimethyl-[2-[[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-dithian-2-yl]silane |
| SMILES | C[Si](C)(C)C1(C[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)SCCCS1 |
| InChI | InChI=1S/C42H52O5S2Si/c1-50(2,3)42(48-25-16-26-49-42)27-37-39(44-29-34-19-10-5-11-20-34)41(46-31-36-23-14-7-15-24-36)40(45-30-35-21-12-6-13-22-35)38(47-37)32-43-28-33-17-8-4-9-18-33/h4-15,17-24,37-41H,16,25-32H2,1-3H3/t37-,38+,39-,40+,41+/m0/s1 |
| InChIKey | UKOFBFPEMQUFCM-XWASVSOJSA-N |
| XLogP | 9.56 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.09 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|