C20H30N2O2 — CID 112972191
1-[2-(cyclohexen-1-yl)ethyl]-3-[2-(2-propan-2-ylphenoxy)ethyl]urea (PubChem CID 112972191) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-[2-(2-propan-2-ylphenoxy)ethyl]urea.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[2-(2-propan-2-ylphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 112972191 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[2-(2-propan-2-ylphenoxy)ethyl]urea |
| SMILES | CC(C)c1ccccc1OCCNC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C20H30N2O2/c1-16(2)18-10-6-7-11-19(18)24-15-14-22-20(23)21-13-12-17-8-4-3-5-9-17/h6-8,10-11,16H,3-5,9,12-15H2,1-2H3,(H2,21,22,23) |
| InChIKey | GRCFRUFIOQJQNY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|