C16H26N2O2 — CID 112973500
1-[2-(2,5-dimethylphenoxy)ethyl]-3-(3-methylbutyl)urea (PubChem CID 112973500) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylphenoxy)ethyl]-3-(3-methylbutyl)urea.
| Compound Name | 1-[2-(2,5-dimethylphenoxy)ethyl]-3-(3-methylbutyl)urea |
|---|---|
| PubChem CID | 112973500 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 1-[2-(2,5-dimethylphenoxy)ethyl]-3-(3-methylbutyl)urea |
| SMILES | Cc1ccc(C)c(OCCNC(=O)NCCC(C)C)c1 |
| InChI | InChI=1S/C16H26N2O2/c1-12(2)7-8-17-16(19)18-9-10-20-15-11-13(3)5-6-14(15)4/h5-6,11-12H,7-10H2,1-4H3,(H2,17,18,19) |
| InChIKey | PTZODTDIWLAFHE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|