C20H25N3O3 — CID 112974507
N-[3-[2-(2,4,5-trimethylphenoxy)ethylcarbamoylamino]phenyl]acetamide (PubChem CID 112974507) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[3-[2-(2,4,5-trimethylphenoxy)ethylcarbamoylamino]phenyl]acetamide.
| Compound Name | N-[3-[2-(2,4,5-trimethylphenoxy)ethylcarbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 112974507 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[3-[2-(2,4,5-trimethylphenoxy)ethylcarbamoylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)NCCOc2cc(C)c(C)cc2C)c1 |
| InChI | InChI=1S/C20H25N3O3/c1-13-10-15(3)19(11-14(13)2)26-9-8-21-20(25)23-18-7-5-6-17(12-18)22-16(4)24/h5-7,10-12H,8-9H2,1-4H3,(H,22,24)(H2,21,23,25) |
| InChIKey | DWYDYWKTRHVEPJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|