C21H26N2O3 — CID 112974871
1-[(2-methoxyphenyl)methyl]-3-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]urea (PubChem CID 112974871) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)methyl]-3-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]urea.
| Compound Name | 1-[(2-methoxyphenyl)methyl]-3-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]urea |
|---|---|
| PubChem CID | 112974871 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-[(2-methoxyphenyl)methyl]-3-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]urea |
| SMILES | COc1ccccc1CNC(=O)NCCOc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C21H26N2O3/c1-25-20-9-5-4-8-18(20)15-23-21(24)22-12-13-26-19-11-10-16-6-2-3-7-17(16)14-19/h4-5,8-11,14H,2-3,6-7,12-13,15H2,1H3,(H2,22,23,24) |
| InChIKey | HUZJGSUYXSPLFE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|