C21H23N3O3 — CID 112975985
1-[2-(2-methoxyphenyl)ethyl]-3-(2-quinolin-8-yloxyethyl)urea (PubChem CID 112975985) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenyl)ethyl]-3-(2-quinolin-8-yloxyethyl)urea.
| Compound Name | 1-[2-(2-methoxyphenyl)ethyl]-3-(2-quinolin-8-yloxyethyl)urea |
|---|---|
| PubChem CID | 112975985 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-[2-(2-methoxyphenyl)ethyl]-3-(2-quinolin-8-yloxyethyl)urea |
| SMILES | COc1ccccc1CCNC(=O)NCCOc1cccc2cccnc12 |
| InChI | InChI=1S/C21H23N3O3/c1-26-18-9-3-2-6-16(18)11-13-23-21(25)24-14-15-27-19-10-4-7-17-8-5-12-22-20(17)19/h2-10,12H,11,13-15H2,1H3,(H2,23,24,25) |
| InChIKey | XCMTWAFGPLJLTK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|