C20H25ClN2O4 — CID 112976514
1-[2-(4-chloro-2-methylphenoxy)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]urea (PubChem CID 112976514) has the molecular formula C20H25ClN2O4 and a molecular weight of 392.88 g/mol. Its IUPAC name is 1-[2-(4-chloro-2-methylphenoxy)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]urea.
| Compound Name | 1-[2-(4-chloro-2-methylphenoxy)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 112976514 |
| Molecular Formula | C20H25ClN2O4 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-[2-(4-chloro-2-methylphenoxy)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(CCNC(=O)NCCOc2ccc(Cl)cc2C)cc1OC |
| InChI | InChI=1S/C20H25ClN2O4/c1-14-12-16(21)5-7-17(14)27-11-10-23-20(24)22-9-8-15-4-6-18(25-2)19(13-15)26-3/h4-7,12-13H,8-11H2,1-3H3,(H2,22,23,24) |
| InChIKey | IOKXYQASOHUZHT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|