C17H16ClN3O2 — CID 112976946
1-[2-(2-chloro-5-methylphenoxy)ethyl]-3-(3-cyanophenyl)urea (PubChem CID 112976946) has the molecular formula C17H16ClN3O2 and a molecular weight of 329.79 g/mol. Its IUPAC name is 1-[2-(2-chloro-5-methylphenoxy)ethyl]-3-(3-cyanophenyl)urea.
| Compound Name | 1-[2-(2-chloro-5-methylphenoxy)ethyl]-3-(3-cyanophenyl)urea |
|---|---|
| PubChem CID | 112976946 |
| Molecular Formula | C17H16ClN3O2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 1-[2-(2-chloro-5-methylphenoxy)ethyl]-3-(3-cyanophenyl)urea |
| SMILES | Cc1ccc(Cl)c(OCCNC(=O)Nc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C17H16ClN3O2/c1-12-5-6-15(18)16(9-12)23-8-7-20-17(22)21-14-4-2-3-13(10-14)11-19/h2-6,9-10H,7-8H2,1H3,(H2,20,21,22) |
| InChIKey | MDGUHPOSEXAGAZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|