C17H18ClFN2O3 — CID 112976989
1-[2-(2-chloro-4-fluorophenoxy)ethyl]-3-[(4-methoxyphenyl)methyl]urea (PubChem CID 112976989) has the molecular formula C17H18ClFN2O3 and a molecular weight of 352.79 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-fluorophenoxy)ethyl]-3-[(4-methoxyphenyl)methyl]urea.
| Compound Name | 1-[2-(2-chloro-4-fluorophenoxy)ethyl]-3-[(4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 112976989 |
| Molecular Formula | C17H18ClFN2O3 |
| Molecular Weight | 352.79 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 1-[2-(2-chloro-4-fluorophenoxy)ethyl]-3-[(4-methoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)NCCOc2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C17H18ClFN2O3/c1-23-14-5-2-12(3-6-14)11-21-17(22)20-8-9-24-16-7-4-13(19)10-15(16)18/h2-7,10H,8-9,11H2,1H3,(H2,20,21,22) |
| InChIKey | LUDSPHUGBNWOSF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.79 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|