C19H23NO2 — CID 112977936
N-benzyl-N-methyl-2-(2,3,6-trimethylphenoxy)acetamide (PubChem CID 112977936) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-(2,3,6-trimethylphenoxy)acetamide.
| Compound Name | N-benzyl-N-methyl-2-(2,3,6-trimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 112977936 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-benzyl-N-methyl-2-(2,3,6-trimethylphenoxy)acetamide |
| SMILES | Cc1ccc(C)c(OCC(=O)N(C)Cc2ccccc2)c1C |
| InChI | InChI=1S/C19H23NO2/c1-14-10-11-15(2)19(16(14)3)22-13-18(21)20(4)12-17-8-6-5-7-9-17/h5-11H,12-13H2,1-4H3 |
| InChIKey | IQQDTMZOZJODLX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |