C23H23ClF3N5O — CID 1129794
[5-(4-chlorophenyl)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone (PubChem CID 1129794) has the molecular formula C23H23ClF3N5O and a molecular weight of 477.92 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone.
| Compound Name | [5-(4-chlorophenyl)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone |
|---|---|
| PubChem CID | 1129794 |
| Molecular Formula | C23H23ClF3N5O |
| Molecular Weight | 477.92 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | [5-(4-chlorophenyl)-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone |
| SMILES | CC1(C)C[C@@H]2C[C@@](C)(CN2C(=O)c2nc3nc(-c4ccc(Cl)cc4)cc(C(F)(F)F)n3n2)C1 |
| InChI | InChI=1S/C23H23ClF3N5O/c1-21(2)9-15-10-22(3,11-21)12-31(15)19(33)18-29-20-28-16(13-4-6-14(24)7-5-13)8-17(23(25,26)27)32(20)30-18/h4-8,15H,9-12H2,1-3H3/t15-,22-/m1/s1 |
| InChIKey | VQFYVBSMMJCOSI-IVZQSRNASA-N |
| XLogP | 5.50 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.92 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |