About (6R,7aS)-6-hydroxy-7,7a-dihydro-6H-1-benzofuran-2-one
(6R,7aS)-6-hydroxy-7,7a-dihydro-6H-1-benzofuran-2-one (PubChem CID 11298065) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is (6R,7aS)-6-hydroxy-7,7a-dihydro-6H-1-benzofuran-2-one.
Molecular Properties
| Compound Name | (6R,7aS)-6-hydroxy-7,7a-dihydro-6H-1-benzofuran-2-one |
| PubChem CID | 11298065 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | (6R,7aS)-6-hydroxy-7,7a-dihydro-6H-1-benzofuran-2-one |
| SMILES | O=C1C=C2C=C[C@H](O)C[C@@H]2O1 |
| InChI | InChI=1S/C8H8O3/c9-6-2-1-5-3-8(10)11-7(5)4-6/h1-3,6-7,9H,4H2/t6-,7-/m0/s1 |
| InChIKey | RAXNUTINVDSFEU-BQBZGAKWSA-N |
| XLogP | 0.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6R,7aS)-6-hydroxy-7,7a-dihydro-6H-1-benzofuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R,7aS)-6-hydroxy-7,7a-dihydro-6H-1-benzofuran-2-one?
The IUPAC name of (6R,7aS)-6-hydroxy-7,7a-dihydro-6H-1-benzofuran-2-one (CID 11298065) is (6R,7aS)-6-hydroxy-7,7a-dihydro-6H-1-benzofuran-2-one.
What is the SMILES notation for (6R,7aS)-6-hydroxy-7,7a-dihydro-6H-1-benzofuran-2-one?
The canonical SMILES for (6R,7aS)-6-hydroxy-7,7a-dihydro-6H-1-benzofuran-2-one is O=C1C=C2C=C[C@H](O)C[C@@H]2O1.
What is the InChIKey of (6R,7aS)-6-hydroxy-7,7a-dihydro-6H-1-benzofuran-2-one?
The InChIKey is RAXNUTINVDSFEU-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H8O3/c9-6-2-1-5-3-8(10)11-7(5)4-6/h1-3,6-7,9H,4H2/t6-,7-/m0/s1.
What are the key properties of (6R,7aS)-6-hydroxy-7,7a-dihydro-6H-1-benzofuran-2-one?
(6R,7aS)-6-hydroxy-7,7a-dihydro-6H-1-benzofuran-2-one has a molecular weight of 152.15 g/mol, XLogP of 0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R,7aS)-6-hydroxy-7,7a-dihydro-6H-1-benzofuran-2-one is sourced from PubChem (CID 11298065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).