About 5-phenyl-4,5-dihydro-1H-imidazol-2-amine
5-phenyl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 11298130) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 5-phenyl-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | 5-phenyl-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 11298130 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 5-phenyl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | NC1=NCC(c2ccccc2)N1 |
| InChI | InChI=1S/C9H11N3/c10-9-11-6-8(12-9)7-4-2-1-3-5-7/h1-5,8H,6H2,(H3,10,11,12) |
| InChIKey | BHUSOIQBDQNPAZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-phenyl-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of 5-phenyl-4,5-dihydro-1H-imidazol-2-amine (CID 11298130) is 5-phenyl-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for 5-phenyl-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for 5-phenyl-4,5-dihydro-1H-imidazol-2-amine is NC1=NCC(c2ccccc2)N1.
What is the InChIKey of 5-phenyl-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is BHUSOIQBDQNPAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c10-9-11-6-8(12-9)7-4-2-1-3-5-7/h1-5,8H,6H2,(H3,10,11,12).
What are the key properties of 5-phenyl-4,5-dihydro-1H-imidazol-2-amine?
5-phenyl-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 161.21 g/mol, XLogP of 0.65, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 11298130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).