C20H18F2N2O2S — CID 112982509
4-fluoro-N-[4-[(4-fluorophenyl)methylamino]phenyl]-3-methylbenzenesulfonamide (PubChem CID 112982509) has the molecular formula C20H18F2N2O2S and a molecular weight of 388.44 g/mol. Its IUPAC name is 4-fluoro-N-[4-[(4-fluorophenyl)methylamino]phenyl]-3-methylbenzenesulfonamide.
| Compound Name | 4-fluoro-N-[4-[(4-fluorophenyl)methylamino]phenyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 112982509 |
| Molecular Formula | C20H18F2N2O2S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 4-fluoro-N-[4-[(4-fluorophenyl)methylamino]phenyl]-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(NCc3ccc(F)cc3)cc2)ccc1F |
| InChI | InChI=1S/C20H18F2N2O2S/c1-14-12-19(10-11-20(14)22)27(25,26)24-18-8-6-17(7-9-18)23-13-15-2-4-16(21)5-3-15/h2-12,23-24H,13H2,1H3 |
| InChIKey | XHKGLWBYVVZNBV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |