C21H17F3N2O2 — CID 112982662
2,3,4-trifluoro-N-[4-[(2-methoxyphenyl)methylamino]phenyl]benzamide (PubChem CID 112982662) has the molecular formula C21H17F3N2O2 and a molecular weight of 386.37 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[4-[(2-methoxyphenyl)methylamino]phenyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[4-[(2-methoxyphenyl)methylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 112982662 |
| Molecular Formula | C21H17F3N2O2 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2,3,4-trifluoro-N-[4-[(2-methoxyphenyl)methylamino]phenyl]benzamide |
| SMILES | COc1ccccc1CNc1ccc(NC(=O)c2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C21H17F3N2O2/c1-28-18-5-3-2-4-13(18)12-25-14-6-8-15(9-7-14)26-21(27)16-10-11-17(22)20(24)19(16)23/h2-11,25H,12H2,1H3,(H,26,27) |
| InChIKey | CAIUUFADPXKLLW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|