About 1-(2-adamantyl)ethanone
1-(2-adamantyl)ethanone (PubChem CID 11298285) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is 1-(2-adamantyl)ethanone.
Molecular Properties
| Compound Name | 1-(2-adamantyl)ethanone |
| PubChem CID | 11298285 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 1-(2-adamantyl)ethanone |
| SMILES | CC(=O)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C12H18O/c1-7(13)12-10-3-8-2-9(5-10)6-11(12)4-8/h8-12H,2-6H2,1H3 |
| InChIKey | SAQHGEILSGZDQP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-adamantyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-adamantyl)ethanone?
The IUPAC name of 1-(2-adamantyl)ethanone (CID 11298285) is 1-(2-adamantyl)ethanone.
What is the SMILES notation for 1-(2-adamantyl)ethanone?
The canonical SMILES for 1-(2-adamantyl)ethanone is CC(=O)C1C2CC3CC(C2)CC1C3.
What is the InChIKey of 1-(2-adamantyl)ethanone?
The InChIKey is SAQHGEILSGZDQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-7(13)12-10-3-8-2-9(5-10)6-11(12)4-8/h8-12H,2-6H2,1H3.
What are the key properties of 1-(2-adamantyl)ethanone?
1-(2-adamantyl)ethanone has a molecular weight of 178.27 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-adamantyl)ethanone is sourced from PubChem (CID 11298285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).