C20H19N3O2 — CID 112983018
4-methoxy-N-[4-(pyridin-3-ylmethylamino)phenyl]benzamide (PubChem CID 112983018) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-methoxy-N-[4-(pyridin-3-ylmethylamino)phenyl]benzamide.
| Compound Name | 4-methoxy-N-[4-(pyridin-3-ylmethylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 112983018 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 4-methoxy-N-[4-(pyridin-3-ylmethylamino)phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(NCc3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C20H19N3O2/c1-25-19-10-4-16(5-11-19)20(24)23-18-8-6-17(7-9-18)22-14-15-3-2-12-21-13-15/h2-13,22H,14H2,1H3,(H,23,24) |
| InChIKey | TUUWUPDTSKYGSI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |