piperidine-1-sulfonyl chloride

C5H10ClNO2S — CID 11298344

IUPACpiperidine-1-sulfonyl chloride
SMILESO=S(=O)(Cl)N1CCCCC1
InChIInChI=1S/C5H10ClNO2S/c6-10(8,9)7-4-2-1-3-5-7/h1-5H2
InChIKeyQQJYAXDCMMXECR-UHFFFAOYSA-N
MW183.66 g/mol
LogP0.96
Rot. Bonds1

About piperidine-1-sulfonyl chloride

piperidine-1-sulfonyl chloride (PubChem CID 11298344) has the molecular formula C5H10ClNO2S and a molecular weight of 183.66 g/mol. Its IUPAC name is piperidine-1-sulfonyl chloride.

Molecular Properties

Compound Namepiperidine-1-sulfonyl chloride
PubChem CID11298344
Molecular FormulaC5H10ClNO2S
Molecular Weight183.66 g/mol
Exact Mass183.01
IUPAC Namepiperidine-1-sulfonyl chloride
SMILESO=S(=O)(Cl)N1CCCCC1
InChIInChI=1S/C5H10ClNO2S/c6-10(8,9)7-4-2-1-3-5-7/h1-5H2
InChIKeyQQJYAXDCMMXECR-UHFFFAOYSA-N
XLogP0.96
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.66
LogP ≤ 50.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze piperidine-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of piperidine-1-sulfonyl chloride?
The IUPAC name of piperidine-1-sulfonyl chloride (CID 11298344) is piperidine-1-sulfonyl chloride.
What is the SMILES notation for piperidine-1-sulfonyl chloride?
The canonical SMILES for piperidine-1-sulfonyl chloride is O=S(=O)(Cl)N1CCCCC1.
What is the InChIKey of piperidine-1-sulfonyl chloride?
The InChIKey is QQJYAXDCMMXECR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10ClNO2S/c6-10(8,9)7-4-2-1-3-5-7/h1-5H2.
What are the key properties of piperidine-1-sulfonyl chloride?
piperidine-1-sulfonyl chloride has a molecular weight of 183.66 g/mol, XLogP of 0.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-1-sulfonyl chloride is sourced from PubChem (CID 11298344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).